C20H20N2O4S — CID 171339380
3-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[3-(hydroxymethyl)phenyl]benzamide;formic acid (PubChem CID 171339380) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is 3-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[3-(hydroxymethyl)phenyl]benzamide;formic acid.
| Compound Name | 3-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[3-(hydroxymethyl)phenyl]benzamide;formic acid |
|---|---|
| PubChem CID | 171339380 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 3-(2,4-dimethyl-1,3-thiazol-5-yl)-N-[3-(hydroxymethyl)phenyl]benzamide;formic acid |
| SMILES | Cc1nc(C)c(-c2cccc(C(=O)Nc3cccc(CO)c3)c2)s1.O=CO |
| InChI | InChI=1S/C19H18N2O2S.CH2O2/c1-12-18(24-13(2)20-12)15-6-4-7-16(10-15)19(23)21-17-8-3-5-14(9-17)11-22;2-1-3/h3-10,22H,11H2,1-2H3,(H,21,23);1H,(H,2,3) |
| InChIKey | YSRANJSYPXIXCL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|