C24H24N4O6 — CID 171339557
2-[2-[6-amino-5-cyano-4-(2,4-dimethoxy-3-methylphenyl)-2-pyridinyl]phenoxy]acetamide;formic acid (PubChem CID 171339557) has the molecular formula C24H24N4O6 and a molecular weight of 464.48 g/mol. Its IUPAC name is 2-[2-[6-amino-5-cyano-4-(2,4-dimethoxy-3-methylphenyl)-2-pyridinyl]phenoxy]acetamide;formic acid.
| Compound Name | 2-[2-[6-amino-5-cyano-4-(2,4-dimethoxy-3-methylphenyl)-2-pyridinyl]phenoxy]acetamide;formic acid |
|---|---|
| PubChem CID | 171339557 |
| Molecular Formula | C24H24N4O6 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 2-[2-[6-amino-5-cyano-4-(2,4-dimethoxy-3-methylphenyl)-2-pyridinyl]phenoxy]acetamide;formic acid |
| SMILES | COc1ccc(-c2cc(-c3ccccc3OCC(N)=O)nc(N)c2C#N)c(OC)c1C.O=CO |
| InChI | InChI=1S/C23H22N4O4.CH2O2/c1-13-19(29-2)9-8-14(22(13)30-3)16-10-18(27-23(26)17(16)11-24)15-6-4-5-7-20(15)31-12-21(25)28;2-1-3/h4-10H,12H2,1-3H3,(H2,25,28)(H2,26,27);1H,(H,2,3) |
| InChIKey | FODMZRGKWAZAHL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|