C24H27N3O2 — CID 171339584
N-[[(1S,5S,6R,7R)-3-(5-methyl-2-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide (PubChem CID 171339584) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is N-[[(1S,5S,6R,7R)-3-(5-methyl-2-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide.
| Compound Name | N-[[(1S,5S,6R,7R)-3-(5-methyl-2-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 171339584 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | N-[[(1S,5S,6R,7R)-3-(5-methyl-2-pyridinyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]-3-phenylprop-2-enamide |
| SMILES | Cc1ccc(N2C[C@@H]3[C@H](CNC(=O)C=Cc4ccccc4)[C@H]4CC[C@]3(C2)O4)nc1 |
| InChI | InChI=1S/C24H27N3O2/c1-17-7-9-22(25-13-17)27-15-20-19(21-11-12-24(20,16-27)29-21)14-26-23(28)10-8-18-5-3-2-4-6-18/h2-10,13,19-21H,11-12,14-16H2,1H3,(H,26,28)/t19-,20+,21+,24+/m0/s1 |
| InChIKey | BJXZGQXSXCJRFY-FBHSLPMESA-N |
| XLogP | 3.20 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|