About 3,3-difluoro-2-(1,2-oxazol-3-yl)propan-1-amine;hydrochloride
3,3-difluoro-2-(1,2-oxazol-3-yl)propan-1-amine;hydrochloride (PubChem CID 171340437) has the molecular formula C6H9ClF2N2O
and a molecular weight of 198.60 g/mol. Its IUPAC name is 3,3-difluoro-2-(1,2-oxazol-3-yl)propan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 3,3-difluoro-2-(1,2-oxazol-3-yl)propan-1-amine;hydrochloride |
| PubChem CID | 171340437 |
| Molecular Formula | C6H9ClF2N2O |
| Molecular Weight | 198.60 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 3,3-difluoro-2-(1,2-oxazol-3-yl)propan-1-amine;hydrochloride |
| SMILES | Cl.NCC(c1ccon1)C(F)F |
| InChI | InChI=1S/C6H8F2N2O.ClH/c7-6(8)4(3-9)5-1-2-11-10-5;/h1-2,4,6H,3,9H2;1H |
| InChIKey | KGKVMWIUCOGIOV-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.60 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-difluoro-2-(1,2-oxazol-3-yl)propan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-2-(1,2-oxazol-3-yl)propan-1-amine;hydrochloride?
The IUPAC name of 3,3-difluoro-2-(1,2-oxazol-3-yl)propan-1-amine;hydrochloride (CID 171340437) is 3,3-difluoro-2-(1,2-oxazol-3-yl)propan-1-amine;hydrochloride.
What is the SMILES notation for 3,3-difluoro-2-(1,2-oxazol-3-yl)propan-1-amine;hydrochloride?
The canonical SMILES for 3,3-difluoro-2-(1,2-oxazol-3-yl)propan-1-amine;hydrochloride is Cl.NCC(c1ccon1)C(F)F.
What is the InChIKey of 3,3-difluoro-2-(1,2-oxazol-3-yl)propan-1-amine;hydrochloride?
The InChIKey is KGKVMWIUCOGIOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N2O.ClH/c7-6(8)4(3-9)5-1-2-11-10-5;/h1-2,4,6H,3,9H2;1H.
What are the key properties of 3,3-difluoro-2-(1,2-oxazol-3-yl)propan-1-amine;hydrochloride?
3,3-difluoro-2-(1,2-oxazol-3-yl)propan-1-amine;hydrochloride has a molecular weight of 198.60 g/mol, XLogP of 1.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-2-(1,2-oxazol-3-yl)propan-1-amine;hydrochloride is sourced from PubChem (CID 171340437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).