About (5R)-2,5-diphenyl-5-propan-2-yl-1,3-oxazol-4-one
(5R)-2,5-diphenyl-5-propan-2-yl-1,3-oxazol-4-one (PubChem CID 171341368) has the molecular formula C18H17NO2
and a molecular weight of 279.34 g/mol. Its IUPAC name is (5R)-2,5-diphenyl-5-propan-2-yl-1,3-oxazol-4-one.
Molecular Properties
| Compound Name | (5R)-2,5-diphenyl-5-propan-2-yl-1,3-oxazol-4-one |
| PubChem CID | 171341368 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (5R)-2,5-diphenyl-5-propan-2-yl-1,3-oxazol-4-one |
| SMILES | CC(C)[C@]1(c2ccccc2)OC(c2ccccc2)=NC1=O |
| InChI | InChI=1S/C18H17NO2/c1-13(2)18(15-11-7-4-8-12-15)17(20)19-16(21-18)14-9-5-3-6-10-14/h3-13H,1-2H3/t18-/m1/s1 |
| InChIKey | YIXJFOAQKFEGRG-GOSISDBHSA-N |
| XLogP | 3.54 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-2,5-diphenyl-5-propan-2-yl-1,3-oxazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-2,5-diphenyl-5-propan-2-yl-1,3-oxazol-4-one?
The IUPAC name of (5R)-2,5-diphenyl-5-propan-2-yl-1,3-oxazol-4-one (CID 171341368) is (5R)-2,5-diphenyl-5-propan-2-yl-1,3-oxazol-4-one.
What is the SMILES notation for (5R)-2,5-diphenyl-5-propan-2-yl-1,3-oxazol-4-one?
The canonical SMILES for (5R)-2,5-diphenyl-5-propan-2-yl-1,3-oxazol-4-one is CC(C)[C@]1(c2ccccc2)OC(c2ccccc2)=NC1=O.
What is the InChIKey of (5R)-2,5-diphenyl-5-propan-2-yl-1,3-oxazol-4-one?
The InChIKey is YIXJFOAQKFEGRG-GOSISDBHSA-N. The full InChI is InChI=1S/C18H17NO2/c1-13(2)18(15-11-7-4-8-12-15)17(20)19-16(21-18)14-9-5-3-6-10-14/h3-13H,1-2H3/t18-/m1/s1.
What are the key properties of (5R)-2,5-diphenyl-5-propan-2-yl-1,3-oxazol-4-one?
(5R)-2,5-diphenyl-5-propan-2-yl-1,3-oxazol-4-one has a molecular weight of 279.34 g/mol, XLogP of 3.54, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-2,5-diphenyl-5-propan-2-yl-1,3-oxazol-4-one is sourced from PubChem (CID 171341368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).