C32H46O6 — CID 171342042
[(4S,5S,6S)-4-methyl-5-[(E)-2-(3-methylbut-2-enoyloxy)ethenyl]-4-(4-methylpent-3-enyl)-7-oxo-6-(2-oxopropyl)cyclohepten-1-yl]methyl cyclohexanecarboxylate (PubChem CID 171342042) has the molecular formula C32H46O6 and a molecular weight of 526.71 g/mol. Its IUPAC name is [(4S,5S,6S)-4-methyl-5-[(E)-2-(3-methylbut-2-enoyloxy)ethenyl]-4-(4-methylpent-3-enyl)-7-oxo-6-(2-oxopropyl)cyclohepten-1-yl]methyl cyclohexanecarboxylate.
| Compound Name | [(4S,5S,6S)-4-methyl-5-[(E)-2-(3-methylbut-2-enoyloxy)ethenyl]-4-(4-methylpent-3-enyl)-7-oxo-6-(2-oxopropyl)cyclohepten-1-yl]methyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 171342042 |
| Molecular Formula | C32H46O6 |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | [(4S,5S,6S)-4-methyl-5-[(E)-2-(3-methylbut-2-enoyloxy)ethenyl]-4-(4-methylpent-3-enyl)-7-oxo-6-(2-oxopropyl)cyclohepten-1-yl]methyl cyclohexanecarboxylate |
| SMILES | CC(=O)C[C@@H]1C(=O)C(COC(=O)C2CCCCC2)=CC[C@](C)(CCC=C(C)C)[C@H]1/C=C/OC(=O)C=C(C)C |
| InChI | InChI=1S/C32H46O6/c1-22(2)11-10-16-32(6)17-14-26(21-38-31(36)25-12-8-7-9-13-25)30(35)27(20-24(5)33)28(32)15-18-37-29(34)19-23(3)4/h11,14-15,18-19,25,27-28H,7-10,12-13,16-17,20-21H2,1-6H3/b18-15+/t27-,28-,32-/m0/s1 |
| InChIKey | BCWLZMRFPMMJCU-XHYSKUSKSA-N |
| XLogP | 7.00 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|