C19H23N5O6S — CID 171342117
N-[3-methoxy-1-[[5-[(4-nitrophenyl)methyl]-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]oxane-4-carboxamide (PubChem CID 171342117) has the molecular formula C19H23N5O6S and a molecular weight of 449.49 g/mol. Its IUPAC name is N-[3-methoxy-1-[[5-[(4-nitrophenyl)methyl]-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]oxane-4-carboxamide.
| Compound Name | N-[3-methoxy-1-[[5-[(4-nitrophenyl)methyl]-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 171342117 |
| Molecular Formula | C19H23N5O6S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[3-methoxy-1-[[5-[(4-nitrophenyl)methyl]-1,3,4-thiadiazol-2-yl]amino]-1-oxopropan-2-yl]oxane-4-carboxamide |
| SMILES | COCC(NC(=O)C1CCOCC1)C(=O)Nc1nnc(Cc2ccc([N+](=O)[O-])cc2)s1 |
| InChI | InChI=1S/C19H23N5O6S/c1-29-11-15(20-17(25)13-6-8-30-9-7-13)18(26)21-19-23-22-16(31-19)10-12-2-4-14(5-3-12)24(27)28/h2-5,13,15H,6-11H2,1H3,(H,20,25)(H,21,23,26) |
| InChIKey | ZTUXPKUNPNABDT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|