C18H15Br2N2+ — CID 171342229
2-(2,4-dibromophenyl)-9-methyl-3,4-dihydropyrido[3,4-b]indol-2-ium (PubChem CID 171342229) has the molecular formula C18H15Br2N2+ and a molecular weight of 419.14 g/mol. Its IUPAC name is 2-(2,4-dibromophenyl)-9-methyl-3,4-dihydropyrido[3,4-b]indol-2-ium.
| Compound Name | 2-(2,4-dibromophenyl)-9-methyl-3,4-dihydropyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 171342229 |
| Molecular Formula | C18H15Br2N2+ |
| Molecular Weight | 419.14 g/mol |
| Exact Mass | 416.96 |
| IUPAC Name | 2-(2,4-dibromophenyl)-9-methyl-3,4-dihydropyrido[3,4-b]indol-2-ium |
| SMILES | Cn1c2c(c3ccccc31)CC[N+](c1ccc(Br)cc1Br)=C2 |
| InChI | InChI=1S/C18H15Br2N2/c1-21-16-5-3-2-4-13(16)14-8-9-22(11-18(14)21)17-7-6-12(19)10-15(17)20/h2-7,10-11H,8-9H2,1H3/q+1 |
| InChIKey | NSOFLDDEIGBZAU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.14 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|