C24H32O4 — CID 171342253
(1R,5R,7R)-3-acetyl-4-hydroxy-8,8-dimethyl-7-(3-methylbut-2-enyl)-1,5-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 171342253) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is (1R,5R,7R)-3-acetyl-4-hydroxy-8,8-dimethyl-7-(3-methylbut-2-enyl)-1,5-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (1R,5R,7R)-3-acetyl-4-hydroxy-8,8-dimethyl-7-(3-methylbut-2-enyl)-1,5-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 171342253 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | (1R,5R,7R)-3-acetyl-4-hydroxy-8,8-dimethyl-7-(3-methylbut-2-enyl)-1,5-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | C=CC[C@@]12C[C@@H](CC=C(C)C)C(C)(C)[C@@](CC=C)(C(=O)C(C(C)=O)=C1O)C2=O |
| InChI | InChI=1S/C24H32O4/c1-8-12-23-14-17(11-10-15(3)4)22(6,7)24(13-9-2,21(23)28)20(27)18(16(5)25)19(23)26/h8-10,17,26H,1-2,11-14H2,3-7H3/t17-,23-,24+/m1/s1 |
| InChIKey | GZPHNJNYZJADIU-VEYWIMSWSA-N |
| XLogP | 5.07 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|