About 7-hydroxy-4,8-dimethoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one
7-hydroxy-4,8-dimethoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one (PubChem CID 171342326) has the molecular formula C16H19NO4
and a molecular weight of 289.33 g/mol. Its IUPAC name is 7-hydroxy-4,8-dimethoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 7-hydroxy-4,8-dimethoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one |
| PubChem CID | 171342326 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 7-hydroxy-4,8-dimethoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one |
| SMILES | COc1c(CC=C(C)C)c(=O)[nH]c2c(OC)c(O)ccc12 |
| InChI | InChI=1S/C16H19NO4/c1-9(2)5-6-11-14(20-3)10-7-8-12(18)15(21-4)13(10)17-16(11)19/h5,7-8,18H,6H2,1-4H3,(H,17,19) |
| InChIKey | AZFKJXQYMUMVEP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-4,8-dimethoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-4,8-dimethoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one?
The IUPAC name of 7-hydroxy-4,8-dimethoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one (CID 171342326) is 7-hydroxy-4,8-dimethoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one.
What is the SMILES notation for 7-hydroxy-4,8-dimethoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one?
The canonical SMILES for 7-hydroxy-4,8-dimethoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one is COc1c(CC=C(C)C)c(=O)[nH]c2c(OC)c(O)ccc12.
What is the InChIKey of 7-hydroxy-4,8-dimethoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one?
The InChIKey is AZFKJXQYMUMVEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO4/c1-9(2)5-6-11-14(20-3)10-7-8-12(18)15(21-4)13(10)17-16(11)19/h5,7-8,18H,6H2,1-4H3,(H,17,19).
What are the key properties of 7-hydroxy-4,8-dimethoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one?
7-hydroxy-4,8-dimethoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one has a molecular weight of 289.33 g/mol, XLogP of 2.76, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-4,8-dimethoxy-3-(3-methylbut-2-enyl)-1H-quinolin-2-one is sourced from PubChem (CID 171342326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).