C22H26N6O — CID 171342554
4-[1-(2-aminopyrimidin-4-yl)-3-[(3S)-1-methylpiperidin-3-yl]pyrrolo[3,2-c]pyridin-6-yl]-2-methylbut-3-yn-2-ol (PubChem CID 171342554) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 4-[1-(2-aminopyrimidin-4-yl)-3-[(3S)-1-methylpiperidin-3-yl]pyrrolo[3,2-c]pyridin-6-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[1-(2-aminopyrimidin-4-yl)-3-[(3S)-1-methylpiperidin-3-yl]pyrrolo[3,2-c]pyridin-6-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 171342554 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 4-[1-(2-aminopyrimidin-4-yl)-3-[(3S)-1-methylpiperidin-3-yl]pyrrolo[3,2-c]pyridin-6-yl]-2-methylbut-3-yn-2-ol |
| SMILES | CN1CCC[C@@H](c2cn(-c3ccnc(N)n3)c3cc(C#CC(C)(C)O)ncc23)C1 |
| InChI | InChI=1S/C22H26N6O/c1-22(2,29)8-6-16-11-19-17(12-25-16)18(15-5-4-10-27(3)13-15)14-28(19)20-7-9-24-21(23)26-20/h7,9,11-12,14-15,29H,4-5,10,13H2,1-3H3,(H2,23,24,26)/t15-/m1/s1 |
| InChIKey | NCHXPUWCNFDAKF-OAHLLOKOSA-N |
| XLogP | 2.33 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|