C18H22O4 — CID 171342638
(3aS,9aR,10aR,10bS)-3,3,7,10b-tetramethyl-3a,4,5,9a,10,10a-hexahydro-[2]benzofuro[6,7-f][1]benzofuran-1,8-dione (PubChem CID 171342638) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (3aS,9aR,10aR,10bS)-3,3,7,10b-tetramethyl-3a,4,5,9a,10,10a-hexahydro-[2]benzofuro[6,7-f][1]benzofuran-1,8-dione.
| Compound Name | (3aS,9aR,10aR,10bS)-3,3,7,10b-tetramethyl-3a,4,5,9a,10,10a-hexahydro-[2]benzofuro[6,7-f][1]benzofuran-1,8-dione |
|---|---|
| PubChem CID | 171342638 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (3aS,9aR,10aR,10bS)-3,3,7,10b-tetramethyl-3a,4,5,9a,10,10a-hexahydro-[2]benzofuro[6,7-f][1]benzofuran-1,8-dione |
| SMILES | CC1=C2C=C3CC[C@@H]4C(C)(C)OC(=O)[C@@]4(C)[C@@H]3C[C@H]2OC1=O |
| InChI | InChI=1S/C18H22O4/c1-9-11-7-10-5-6-14-17(2,3)22-16(20)18(14,4)12(10)8-13(11)21-15(9)19/h7,12-14H,5-6,8H2,1-4H3/t12-,13-,14-,18+/m1/s1 |
| InChIKey | IJWJGEMUPIOEHB-MMQJMDILSA-N |
| XLogP | 2.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |