About 2-[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]ethyl 4-sulfamoylbenzoate
2-[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]ethyl 4-sulfamoylbenzoate (PubChem CID 171342716) has the molecular formula C18H15F3N4O4S
and a molecular weight of 440.40 g/mol. Its IUPAC name is 2-[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]ethyl 4-sulfamoylbenzoate.
Molecular Properties
| Compound Name | 2-[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]ethyl 4-sulfamoylbenzoate |
| PubChem CID | 171342716 |
| Molecular Formula | C18H15F3N4O4S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 2-[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]ethyl 4-sulfamoylbenzoate |
| SMILES | NS(=O)(=O)c1ccc(C(=O)OCCn2cc(-c3ccc(C(F)(F)F)cc3)nn2)cc1 |
| InChI | InChI=1S/C18H15F3N4O4S/c19-18(20,21)14-5-1-12(2-6-14)16-11-25(24-23-16)9-10-29-17(26)13-3-7-15(8-4-13)30(22,27)28/h1-8,11H,9-10H2,(H2,22,27,28) |
| InChIKey | NIDOYRIUFNGOLJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]ethyl 4-sulfamoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]ethyl 4-sulfamoylbenzoate?
The IUPAC name of 2-[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]ethyl 4-sulfamoylbenzoate (CID 171342716) is 2-[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]ethyl 4-sulfamoylbenzoate.
What is the SMILES notation for 2-[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]ethyl 4-sulfamoylbenzoate?
The canonical SMILES for 2-[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]ethyl 4-sulfamoylbenzoate is NS(=O)(=O)c1ccc(C(=O)OCCn2cc(-c3ccc(C(F)(F)F)cc3)nn2)cc1.
What is the InChIKey of 2-[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]ethyl 4-sulfamoylbenzoate?
The InChIKey is NIDOYRIUFNGOLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F3N4O4S/c19-18(20,21)14-5-1-12(2-6-14)16-11-25(24-23-16)9-10-29-17(26)13-3-7-15(8-4-13)30(22,27)28/h1-8,11H,9-10H2,(H2,22,27,28).
What are the key properties of 2-[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]ethyl 4-sulfamoylbenzoate?
2-[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]ethyl 4-sulfamoylbenzoate has a molecular weight of 440.40 g/mol, XLogP of 2.47, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-(trifluoromethyl)phenyl]triazol-1-yl]ethyl 4-sulfamoylbenzoate is sourced from PubChem (CID 171342716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).