C33H33N5O5S2 — CID 171343214
3-(butylamino)-N-[(Z)-[4-(4-methoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]amino]-4-phenoxy-5-sulfamoylbenzamide (PubChem CID 171343214) has the molecular formula C33H33N5O5S2 and a molecular weight of 643.79 g/mol. Its IUPAC name is 3-(butylamino)-N-[(Z)-[4-(4-methoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]amino]-4-phenoxy-5-sulfamoylbenzamide.
| Compound Name | 3-(butylamino)-N-[(Z)-[4-(4-methoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]amino]-4-phenoxy-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 171343214 |
| Molecular Formula | C33H33N5O5S2 |
| Molecular Weight | 643.79 g/mol |
| Exact Mass | 643.19 |
| IUPAC Name | 3-(butylamino)-N-[(Z)-[4-(4-methoxyphenyl)-3-phenyl-1,3-thiazol-2-ylidene]amino]-4-phenoxy-5-sulfamoylbenzamide |
| SMILES | CCCCNc1cc(C(=O)N/N=c2\scc(-c3ccc(OC)cc3)n2-c2ccccc2)cc(S(N)(=O)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C33H33N5O5S2/c1-3-4-19-35-28-20-24(21-30(45(34,40)41)31(28)43-27-13-9-6-10-14-27)32(39)36-37-33-38(25-11-7-5-8-12-25)29(22-44-33)23-15-17-26(42-2)18-16-23/h5-18,20-22,35H,3-4,19H2,1-2H3,(H,36,39)(H2,34,40,41)/b37-33- |
| InChIKey | YBEPJTWBUDUYLF-FJSCPDHXSA-N |
| XLogP | 6.11 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.79 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|