C14H19NO4 — CID 171343244
(4R,5S)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-ethyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 171343244) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (4R,5S)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-ethyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (4R,5S)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-ethyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 171343244 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (4R,5S)-1-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-4-ethyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | CC[C@H]1C(=O)NC2([C@@H](O)[C@@H]3C=CCCC3)C(=O)O[C@@H]12 |
| InChI | InChI=1S/C14H19NO4/c1-2-9-11-14(13(18)19-11,15-12(9)17)10(16)8-6-4-3-5-7-8/h4,6,8-11,16H,2-3,5,7H2,1H3,(H,15,17)/t8-,9-,10+,11+,14?/m1/s1 |
| InChIKey | XVHAMJAGYHRHGJ-CAMXFFFOSA-N |
| XLogP | 0.52 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|