C16H15N5O — CID 171343334
11-anilino-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carboxamide (PubChem CID 171343334) has the molecular formula C16H15N5O and a molecular weight of 293.33 g/mol. Its IUPAC name is 11-anilino-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carboxamide.
| Compound Name | 11-anilino-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carboxamide |
|---|---|
| PubChem CID | 171343334 |
| Molecular Formula | C16H15N5O |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 11-anilino-1,8,12-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carboxamide |
| SMILES | NC(=O)c1c(Nc2ccccc2)nn2c3c(cnc12)CCC3 |
| InChI | InChI=1S/C16H15N5O/c17-14(22)13-15(19-11-6-2-1-3-7-11)20-21-12-8-4-5-10(12)9-18-16(13)21/h1-3,6-7,9H,4-5,8H2,(H2,17,22)(H,19,20) |
| InChIKey | XVANEUWFZFYTSG-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |