About 7-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]heptan-1-ol
7-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]heptan-1-ol (PubChem CID 171343406) has the molecular formula C17H22N4O2S
and a molecular weight of 346.46 g/mol. Its IUPAC name is 7-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]heptan-1-ol.
Molecular Properties
| Compound Name | 7-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]heptan-1-ol |
| PubChem CID | 171343406 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 7-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]heptan-1-ol |
| SMILES | COc1ccc2nc(-c3cn(CCCCCCCO)nn3)sc2c1 |
| InChI | InChI=1S/C17H22N4O2S/c1-23-13-7-8-14-16(11-13)24-17(18-14)15-12-21(20-19-15)9-5-3-2-4-6-10-22/h7-8,11-12,22H,2-6,9-10H2,1H3 |
| InChIKey | OFKARVFSHWKASN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]heptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]heptan-1-ol?
The IUPAC name of 7-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]heptan-1-ol (CID 171343406) is 7-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]heptan-1-ol.
What is the SMILES notation for 7-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]heptan-1-ol?
The canonical SMILES for 7-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]heptan-1-ol is COc1ccc2nc(-c3cn(CCCCCCCO)nn3)sc2c1.
What is the InChIKey of 7-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]heptan-1-ol?
The InChIKey is OFKARVFSHWKASN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N4O2S/c1-23-13-7-8-14-16(11-13)24-17(18-14)15-12-21(20-19-15)9-5-3-2-4-6-10-22/h7-8,11-12,22H,2-6,9-10H2,1H3.
What are the key properties of 7-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]heptan-1-ol?
7-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]heptan-1-ol has a molecular weight of 346.46 g/mol, XLogP of 3.51, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]heptan-1-ol is sourced from PubChem (CID 171343406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).