About 4'-(4-bromophenyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one
4'-(4-bromophenyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one (PubChem CID 171343417) has the molecular formula C24H18BrFN2O2
and a molecular weight of 465.32 g/mol. Its IUPAC name is 4'-(4-bromophenyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one.
Molecular Properties
| Compound Name | 4'-(4-bromophenyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one |
| PubChem CID | 171343417 |
| Molecular Formula | C24H18BrFN2O2 |
| Molecular Weight | 465.32 g/mol |
| Exact Mass | 464.05 |
| IUPAC Name | 4'-(4-bromophenyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one |
| SMILES | O=C(c1ccc(F)cc1)C1C(c2ccc(Br)cc2)CNC12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C24H18BrFN2O2/c25-16-9-5-14(6-10-16)18-13-27-24(19-3-1-2-4-20(19)28-23(24)30)21(18)22(29)15-7-11-17(26)12-8-15/h1-12,18,21,27H,13H2,(H,28,30) |
| InChIKey | NXPLBPAMWXMSJJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4'-(4-bromophenyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-(4-bromophenyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one?
The IUPAC name of 4'-(4-bromophenyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one (CID 171343417) is 4'-(4-bromophenyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one.
What is the SMILES notation for 4'-(4-bromophenyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one?
The canonical SMILES for 4'-(4-bromophenyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one is O=C(c1ccc(F)cc1)C1C(c2ccc(Br)cc2)CNC12C(=O)Nc1ccccc12.
What is the InChIKey of 4'-(4-bromophenyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one?
The InChIKey is NXPLBPAMWXMSJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18BrFN2O2/c25-16-9-5-14(6-10-16)18-13-27-24(19-3-1-2-4-20(19)28-23(24)30)21(18)22(29)15-7-11-17(26)12-8-15/h1-12,18,21,27H,13H2,(H,28,30).
What are the key properties of 4'-(4-bromophenyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one?
4'-(4-bromophenyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one has a molecular weight of 465.32 g/mol, XLogP of 4.62, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-(4-bromophenyl)-3'-(4-fluorobenzoyl)spiro[1H-indole-3,2'-pyrrolidine]-2-one is sourced from PubChem (CID 171343417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).