C24H40O6 — CID 171343515
8-[(1R,4R,5S,9R,10E,12R)-5,9,14,14-tetramethyl-2-oxo-3,13,15-trioxabicyclo[10.3.0]pentadec-10-en-4-yl]octanoic acid (PubChem CID 171343515) has the molecular formula C24H40O6 and a molecular weight of 424.58 g/mol. Its IUPAC name is 8-[(1R,4R,5S,9R,10E,12R)-5,9,14,14-tetramethyl-2-oxo-3,13,15-trioxabicyclo[10.3.0]pentadec-10-en-4-yl]octanoic acid.
| Compound Name | 8-[(1R,4R,5S,9R,10E,12R)-5,9,14,14-tetramethyl-2-oxo-3,13,15-trioxabicyclo[10.3.0]pentadec-10-en-4-yl]octanoic acid |
|---|---|
| PubChem CID | 171343515 |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | 8-[(1R,4R,5S,9R,10E,12R)-5,9,14,14-tetramethyl-2-oxo-3,13,15-trioxabicyclo[10.3.0]pentadec-10-en-4-yl]octanoic acid |
| SMILES | C[C@H]1/C=C/[C@H]2OC(C)(C)O[C@H]2C(=O)O[C@H](CCCCCCCC(=O)O)[C@@H](C)CCC1 |
| InChI | InChI=1S/C24H40O6/c1-17-11-10-12-18(2)19(13-8-6-5-7-9-14-21(25)26)28-23(27)22-20(16-15-17)29-24(3,4)30-22/h15-20,22H,5-14H2,1-4H3,(H,25,26)/b16-15+/t17-,18+,19-,20-,22-/m1/s1 |
| InChIKey | STSHRTKOPFMPCS-YWCMLPBGSA-N |
| XLogP | 5.25 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|