C18H26O6 — CID 171343518
(1aR,2R,5R,6R,6aS)-2,6-dihydroxy-5-(2-oxodecyl)-2,5,6,6a-tetrahydro-1aH-oxireno[2,3-f][2]benzofuran-3-one (PubChem CID 171343518) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is (1aR,2R,5R,6R,6aS)-2,6-dihydroxy-5-(2-oxodecyl)-2,5,6,6a-tetrahydro-1aH-oxireno[2,3-f][2]benzofuran-3-one.
| Compound Name | (1aR,2R,5R,6R,6aS)-2,6-dihydroxy-5-(2-oxodecyl)-2,5,6,6a-tetrahydro-1aH-oxireno[2,3-f][2]benzofuran-3-one |
|---|---|
| PubChem CID | 171343518 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (1aR,2R,5R,6R,6aS)-2,6-dihydroxy-5-(2-oxodecyl)-2,5,6,6a-tetrahydro-1aH-oxireno[2,3-f][2]benzofuran-3-one |
| SMILES | CCCCCCCCC(=O)C[C@H]1OC(=O)C2=C1[C@@H](O)[C@@H]1O[C@@H]1[C@@H]2O |
| InChI | InChI=1S/C18H26O6/c1-2-3-4-5-6-7-8-10(19)9-11-12-13(18(22)23-11)15(21)17-16(24-17)14(12)20/h11,14-17,20-21H,2-9H2,1H3/t11-,14-,15-,16+,17-/m1/s1 |
| InChIKey | FSCMEDUHVZQZBK-OFGYBXGMSA-N |
| XLogP | 1.42 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|