C42H28N4O8 — CID 171343595
5-[15-(3,5-dicarboxyphenyl)-10-(4-methylphenyl)-23,24-dihydro-21H-corrin-5-yl]benzene-1,3-dicarboxylic acid (PubChem CID 171343595) has the molecular formula C42H28N4O8 and a molecular weight of 716.71 g/mol. Its IUPAC name is 5-[15-(3,5-dicarboxyphenyl)-10-(4-methylphenyl)-23,24-dihydro-21H-corrin-5-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[15-(3,5-dicarboxyphenyl)-10-(4-methylphenyl)-23,24-dihydro-21H-corrin-5-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 171343595 |
| Molecular Formula | C42H28N4O8 |
| Molecular Weight | 716.71 g/mol |
| Exact Mass | 716.19 |
| IUPAC Name | 5-[15-(3,5-dicarboxyphenyl)-10-(4-methylphenyl)-23,24-dihydro-21H-corrin-5-yl]benzene-1,3-dicarboxylic acid |
| SMILES | Cc1ccc(-c2c3nc(c(-c4cc(C(=O)O)cc(C(=O)O)c4)c4ccc([nH]4)c4ccc([nH]4)c(-c4cc(C(=O)O)cc(C(=O)O)c4)c4ccc2[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C42H28N4O8/c1-20-2-4-21(5-3-20)36-30-10-12-34(45-30)37(22-14-24(39(47)48)18-25(15-22)40(49)50)32-8-6-28(43-32)29-7-9-33(44-29)38(35-13-11-31(36)46-35)23-16-26(41(51)52)19-27(17-23)42(53)54/h2-19,43-45H,1H3,(H,47,48)(H,49,50)(H,51,52)(H,53,54)/b29-28-,36-30-,36-31-,37-32-,37-34-,38-33-,38-35- |
| InChIKey | MNLLCUPTXOFZFU-MIYTUBFASA-N |
| XLogP | 8.80 |
| TPSA | 209.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.71 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |