C18H18O5 — CID 171343677
(1S,11S,12S)-7-hydroxy-12-methyl-14-oxatetracyclo[10.3.3.01,11.03,8]octadeca-3(8),6,9-triene-4,5,13-trione (PubChem CID 171343677) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is (1S,11S,12S)-7-hydroxy-12-methyl-14-oxatetracyclo[10.3.3.01,11.03,8]octadeca-3(8),6,9-triene-4,5,13-trione.
| Compound Name | (1S,11S,12S)-7-hydroxy-12-methyl-14-oxatetracyclo[10.3.3.01,11.03,8]octadeca-3(8),6,9-triene-4,5,13-trione |
|---|---|
| PubChem CID | 171343677 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (1S,11S,12S)-7-hydroxy-12-methyl-14-oxatetracyclo[10.3.3.01,11.03,8]octadeca-3(8),6,9-triene-4,5,13-trione |
| SMILES | C[C@@]12CCC[C@]3(COC1=O)CC1=C(C=C[C@@H]32)C(O)=CC(=O)C1=O |
| InChI | InChI=1S/C18H18O5/c1-17-5-2-6-18(9-23-16(17)22)8-11-10(3-4-14(17)18)12(19)7-13(20)15(11)21/h3-4,7,14,19H,2,5-6,8-9H2,1H3/t14-,17+,18-/m1/s1 |
| InChIKey | BDLNYFLKSNHVHV-FHLIZLRMSA-N |
| XLogP | 2.19 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|