About 3,5-diphenyl-2H-furan-5-ol
3,5-diphenyl-2H-furan-5-ol (PubChem CID 171343752) has the molecular formula C16H14O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 3,5-diphenyl-2H-furan-5-ol.
Molecular Properties
| Compound Name | 3,5-diphenyl-2H-furan-5-ol |
| PubChem CID | 171343752 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3,5-diphenyl-2H-furan-5-ol |
| SMILES | OC1(c2ccccc2)C=C(c2ccccc2)CO1 |
| InChI | InChI=1S/C16H14O2/c17-16(15-9-5-2-6-10-15)11-14(12-18-16)13-7-3-1-4-8-13/h1-11,17H,12H2 |
| InChIKey | SBLNQDAYHCHDTN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-diphenyl-2H-furan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diphenyl-2H-furan-5-ol?
The IUPAC name of 3,5-diphenyl-2H-furan-5-ol (CID 171343752) is 3,5-diphenyl-2H-furan-5-ol.
What is the SMILES notation for 3,5-diphenyl-2H-furan-5-ol?
The canonical SMILES for 3,5-diphenyl-2H-furan-5-ol is OC1(c2ccccc2)C=C(c2ccccc2)CO1.
What is the InChIKey of 3,5-diphenyl-2H-furan-5-ol?
The InChIKey is SBLNQDAYHCHDTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O2/c17-16(15-9-5-2-6-10-15)11-14(12-18-16)13-7-3-1-4-8-13/h1-11,17H,12H2.
What are the key properties of 3,5-diphenyl-2H-furan-5-ol?
3,5-diphenyl-2H-furan-5-ol has a molecular weight of 238.29 g/mol, XLogP of 2.95, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diphenyl-2H-furan-5-ol is sourced from PubChem (CID 171343752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).