About N-(6-aminohexyl)-3-(2,4-difluorophenyl)benzenesulfonamide
N-(6-aminohexyl)-3-(2,4-difluorophenyl)benzenesulfonamide (PubChem CID 171343785) has the molecular formula C18H22F2N2O2S
and a molecular weight of 368.45 g/mol. Its IUPAC name is N-(6-aminohexyl)-3-(2,4-difluorophenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(6-aminohexyl)-3-(2,4-difluorophenyl)benzenesulfonamide |
| PubChem CID | 171343785 |
| Molecular Formula | C18H22F2N2O2S |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-(6-aminohexyl)-3-(2,4-difluorophenyl)benzenesulfonamide |
| SMILES | NCCCCCCNS(=O)(=O)c1cccc(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C18H22F2N2O2S/c19-15-8-9-17(18(20)13-15)14-6-5-7-16(12-14)25(23,24)22-11-4-2-1-3-10-21/h5-9,12-13,22H,1-4,10-11,21H2 |
| InChIKey | ICQXOTCOJSNEON-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(6-aminohexyl)-3-(2,4-difluorophenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-aminohexyl)-3-(2,4-difluorophenyl)benzenesulfonamide?
The IUPAC name of N-(6-aminohexyl)-3-(2,4-difluorophenyl)benzenesulfonamide (CID 171343785) is N-(6-aminohexyl)-3-(2,4-difluorophenyl)benzenesulfonamide.
What is the SMILES notation for N-(6-aminohexyl)-3-(2,4-difluorophenyl)benzenesulfonamide?
The canonical SMILES for N-(6-aminohexyl)-3-(2,4-difluorophenyl)benzenesulfonamide is NCCCCCCNS(=O)(=O)c1cccc(-c2ccc(F)cc2F)c1.
What is the InChIKey of N-(6-aminohexyl)-3-(2,4-difluorophenyl)benzenesulfonamide?
The InChIKey is ICQXOTCOJSNEON-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F2N2O2S/c19-15-8-9-17(18(20)13-15)14-6-5-7-16(12-14)25(23,24)22-11-4-2-1-3-10-21/h5-9,12-13,22H,1-4,10-11,21H2.
What are the key properties of N-(6-aminohexyl)-3-(2,4-difluorophenyl)benzenesulfonamide?
N-(6-aminohexyl)-3-(2,4-difluorophenyl)benzenesulfonamide has a molecular weight of 368.45 g/mol, XLogP of 3.43, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-aminohexyl)-3-(2,4-difluorophenyl)benzenesulfonamide is sourced from PubChem (CID 171343785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).