C22H19N5O4S2 — CID 171343892
(7E)-5-methyl-3-(5-nitrothiophen-2-yl)-7-[(5-nitrothiophen-2-yl)methylidene]-2-phenyl-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 171343892) has the molecular formula C22H19N5O4S2 and a molecular weight of 481.56 g/mol. Its IUPAC name is (7E)-5-methyl-3-(5-nitrothiophen-2-yl)-7-[(5-nitrothiophen-2-yl)methylidene]-2-phenyl-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | (7E)-5-methyl-3-(5-nitrothiophen-2-yl)-7-[(5-nitrothiophen-2-yl)methylidene]-2-phenyl-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 171343892 |
| Molecular Formula | C22H19N5O4S2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | (7E)-5-methyl-3-(5-nitrothiophen-2-yl)-7-[(5-nitrothiophen-2-yl)methylidene]-2-phenyl-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | CN1C/C(=C\c2ccc([N+](=O)[O-])s2)C2=NN(c3ccccc3)C(c3ccc([N+](=O)[O-])s3)C2C1 |
| InChI | InChI=1S/C22H19N5O4S2/c1-24-12-14(11-16-7-9-19(32-16)26(28)29)21-17(13-24)22(18-8-10-20(33-18)27(30)31)25(23-21)15-5-3-2-4-6-15/h2-11,17,22H,12-13H2,1H3/b14-11+ |
| InChIKey | XSUNKMNFCMDQJS-SDNWHVSQSA-N |
| XLogP | 5.19 |
| TPSA | 105.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|