About N-(8-aminooctyl)-3-(2,4-difluorophenyl)benzenesulfonamide
N-(8-aminooctyl)-3-(2,4-difluorophenyl)benzenesulfonamide (PubChem CID 171344135) has the molecular formula C20H26F2N2O2S
and a molecular weight of 396.50 g/mol. Its IUPAC name is N-(8-aminooctyl)-3-(2,4-difluorophenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(8-aminooctyl)-3-(2,4-difluorophenyl)benzenesulfonamide |
| PubChem CID | 171344135 |
| Molecular Formula | C20H26F2N2O2S |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-(8-aminooctyl)-3-(2,4-difluorophenyl)benzenesulfonamide |
| SMILES | NCCCCCCCCNS(=O)(=O)c1cccc(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C20H26F2N2O2S/c21-17-10-11-19(20(22)15-17)16-8-7-9-18(14-16)27(25,26)24-13-6-4-2-1-3-5-12-23/h7-11,14-15,24H,1-6,12-13,23H2 |
| InChIKey | XDZQXXKMTCYYAL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(8-aminooctyl)-3-(2,4-difluorophenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(8-aminooctyl)-3-(2,4-difluorophenyl)benzenesulfonamide?
The IUPAC name of N-(8-aminooctyl)-3-(2,4-difluorophenyl)benzenesulfonamide (CID 171344135) is N-(8-aminooctyl)-3-(2,4-difluorophenyl)benzenesulfonamide.
What is the SMILES notation for N-(8-aminooctyl)-3-(2,4-difluorophenyl)benzenesulfonamide?
The canonical SMILES for N-(8-aminooctyl)-3-(2,4-difluorophenyl)benzenesulfonamide is NCCCCCCCCNS(=O)(=O)c1cccc(-c2ccc(F)cc2F)c1.
What is the InChIKey of N-(8-aminooctyl)-3-(2,4-difluorophenyl)benzenesulfonamide?
The InChIKey is XDZQXXKMTCYYAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26F2N2O2S/c21-17-10-11-19(20(22)15-17)16-8-7-9-18(14-16)27(25,26)24-13-6-4-2-1-3-5-12-23/h7-11,14-15,24H,1-6,12-13,23H2.
What are the key properties of N-(8-aminooctyl)-3-(2,4-difluorophenyl)benzenesulfonamide?
N-(8-aminooctyl)-3-(2,4-difluorophenyl)benzenesulfonamide has a molecular weight of 396.50 g/mol, XLogP of 4.21, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(8-aminooctyl)-3-(2,4-difluorophenyl)benzenesulfonamide is sourced from PubChem (CID 171344135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).