About N-cyclopropyl-4-[4-[3-(3,4-dihydroxybutyl)benzoyl]phenyl]-3-methylbenzamide
N-cyclopropyl-4-[4-[3-(3,4-dihydroxybutyl)benzoyl]phenyl]-3-methylbenzamide (PubChem CID 171344174) has the molecular formula C28H29NO4
and a molecular weight of 443.54 g/mol. Its IUPAC name is N-cyclopropyl-4-[4-[3-(3,4-dihydroxybutyl)benzoyl]phenyl]-3-methylbenzamide.
Molecular Properties
| Compound Name | N-cyclopropyl-4-[4-[3-(3,4-dihydroxybutyl)benzoyl]phenyl]-3-methylbenzamide |
| PubChem CID | 171344174 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | N-cyclopropyl-4-[4-[3-(3,4-dihydroxybutyl)benzoyl]phenyl]-3-methylbenzamide |
| SMILES | Cc1cc(C(=O)NC2CC2)ccc1-c1ccc(C(=O)c2cccc(CCC(O)CO)c2)cc1 |
| InChI | InChI=1S/C28H29NO4/c1-18-15-23(28(33)29-24-11-12-24)10-14-26(18)20-6-8-21(9-7-20)27(32)22-4-2-3-19(16-22)5-13-25(31)17-30/h2-4,6-10,14-16,24-25,30-31H,5,11-13,17H2,1H3,(H,29,33) |
| InChIKey | NJQHNRJYCJEDQF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopropyl-4-[4-[3-(3,4-dihydroxybutyl)benzoyl]phenyl]-3-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-4-[4-[3-(3,4-dihydroxybutyl)benzoyl]phenyl]-3-methylbenzamide?
The IUPAC name of N-cyclopropyl-4-[4-[3-(3,4-dihydroxybutyl)benzoyl]phenyl]-3-methylbenzamide (CID 171344174) is N-cyclopropyl-4-[4-[3-(3,4-dihydroxybutyl)benzoyl]phenyl]-3-methylbenzamide.
What is the SMILES notation for N-cyclopropyl-4-[4-[3-(3,4-dihydroxybutyl)benzoyl]phenyl]-3-methylbenzamide?
The canonical SMILES for N-cyclopropyl-4-[4-[3-(3,4-dihydroxybutyl)benzoyl]phenyl]-3-methylbenzamide is Cc1cc(C(=O)NC2CC2)ccc1-c1ccc(C(=O)c2cccc(CCC(O)CO)c2)cc1.
What is the InChIKey of N-cyclopropyl-4-[4-[3-(3,4-dihydroxybutyl)benzoyl]phenyl]-3-methylbenzamide?
The InChIKey is NJQHNRJYCJEDQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29NO4/c1-18-15-23(28(33)29-24-11-12-24)10-14-26(18)20-6-8-21(9-7-20)27(32)22-4-2-3-19(16-22)5-13-25(31)17-30/h2-4,6-10,14-16,24-25,30-31H,5,11-13,17H2,1H3,(H,29,33).
What are the key properties of N-cyclopropyl-4-[4-[3-(3,4-dihydroxybutyl)benzoyl]phenyl]-3-methylbenzamide?
N-cyclopropyl-4-[4-[3-(3,4-dihydroxybutyl)benzoyl]phenyl]-3-methylbenzamide has a molecular weight of 443.54 g/mol, XLogP of 4.07, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-4-[4-[3-(3,4-dihydroxybutyl)benzoyl]phenyl]-3-methylbenzamide is sourced from PubChem (CID 171344174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).