C20H17N5O4 — CID 171344189
7-[[4-amino-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]methoxy]-4-methylchromen-2-one (PubChem CID 171344189) has the molecular formula C20H17N5O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is 7-[[4-amino-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]methoxy]-4-methylchromen-2-one.
| Compound Name | 7-[[4-amino-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 171344189 |
| Molecular Formula | C20H17N5O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 7-[[4-amino-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]methoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCc3nc(N)nc(Nc4cccc(O)c4)n3)ccc12 |
| InChI | InChI=1S/C20H17N5O4/c1-11-7-18(27)29-16-9-14(5-6-15(11)16)28-10-17-23-19(21)25-20(24-17)22-12-3-2-4-13(26)8-12/h2-9,26H,10H2,1H3,(H3,21,22,23,24,25) |
| InChIKey | PGYVPRQMMYBMPD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|