C6H11N5 — CID 171344344
9-methyl-1,2,3,4-tetrahydropurin-6-amine (PubChem CID 171344344) has the molecular formula C6H11N5 and a molecular weight of 153.19 g/mol. Its IUPAC name is 9-methyl-1,2,3,4-tetrahydropurin-6-amine.
| Compound Name | 9-methyl-1,2,3,4-tetrahydropurin-6-amine |
|---|---|
| PubChem CID | 171344344 |
| Molecular Formula | C6H11N5 |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 9-methyl-1,2,3,4-tetrahydropurin-6-amine |
| SMILES | CN1C=NC2=C(N)NCNC21 |
| InChI | InChI=1S/C6H11N5/c1-11-3-10-4-5(7)8-2-9-6(4)11/h3,6,8-9H,2,7H2,1H3 |
| InChIKey | HOIOSDYQXOMEHE-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |