C22H23BrN2O7 — CID 171344376
4-[5-[4-(3-bromo-4,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-methoxyphenoxy]-N-hydroxybutanamide (PubChem CID 171344376) has the molecular formula C22H23BrN2O7 and a molecular weight of 507.34 g/mol. Its IUPAC name is 4-[5-[4-(3-bromo-4,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-methoxyphenoxy]-N-hydroxybutanamide.
| Compound Name | 4-[5-[4-(3-bromo-4,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-methoxyphenoxy]-N-hydroxybutanamide |
|---|---|
| PubChem CID | 171344376 |
| Molecular Formula | C22H23BrN2O7 |
| Molecular Weight | 507.34 g/mol |
| Exact Mass | 506.07 |
| IUPAC Name | 4-[5-[4-(3-bromo-4,5-dimethoxyphenyl)-1,3-oxazol-5-yl]-2-methoxyphenoxy]-N-hydroxybutanamide |
| SMILES | COc1ccc(-c2ocnc2-c2cc(Br)c(OC)c(OC)c2)cc1OCCCC(=O)NO |
| InChI | InChI=1S/C22H23BrN2O7/c1-28-16-7-6-13(10-17(16)31-8-4-5-19(26)25-27)21-20(24-12-32-21)14-9-15(23)22(30-3)18(11-14)29-2/h6-7,9-12,27H,4-5,8H2,1-3H3,(H,25,26) |
| InChIKey | BPXGEDGFPFAGRC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 112.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|