C13H13N3O3 — CID 171344385
ethyl N-[3-(cyanomethyl)-2-oxo-1,3-dihydroindol-5-yl]carbamate (PubChem CID 171344385) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is ethyl N-[3-(cyanomethyl)-2-oxo-1,3-dihydroindol-5-yl]carbamate.
| Compound Name | ethyl N-[3-(cyanomethyl)-2-oxo-1,3-dihydroindol-5-yl]carbamate |
|---|---|
| PubChem CID | 171344385 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | ethyl N-[3-(cyanomethyl)-2-oxo-1,3-dihydroindol-5-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(c1)C(CC#N)C(=O)N2 |
| InChI | InChI=1S/C13H13N3O3/c1-2-19-13(18)15-8-3-4-11-10(7-8)9(5-6-14)12(17)16-11/h3-4,7,9H,2,5H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | QOXTXWLMKVBAJB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |