C26H28N2O4 — CID 171344392
methyl (1S,9S,14E,15S,16R,19S)-14-ethylidene-6-(furan-3-yl)-2-methyl-18-oxa-2,12-diazahexacyclo[13.3.2.01,9.03,8.09,16.012,19]icosa-3(8),4,6-triene-16-carboxylate (PubChem CID 171344392) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is methyl (1S,9S,14E,15S,16R,19S)-14-ethylidene-6-(furan-3-yl)-2-methyl-18-oxa-2,12-diazahexacyclo[13.3.2.01,9.03,8.09,16.012,19]icosa-3(8),4,6-triene-16-carboxylate.
| Compound Name | methyl (1S,9S,14E,15S,16R,19S)-14-ethylidene-6-(furan-3-yl)-2-methyl-18-oxa-2,12-diazahexacyclo[13.3.2.01,9.03,8.09,16.012,19]icosa-3(8),4,6-triene-16-carboxylate |
|---|---|
| PubChem CID | 171344392 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | methyl (1S,9S,14E,15S,16R,19S)-14-ethylidene-6-(furan-3-yl)-2-methyl-18-oxa-2,12-diazahexacyclo[13.3.2.01,9.03,8.09,16.012,19]icosa-3(8),4,6-triene-16-carboxylate |
| SMILES | C/C=C1/CN2CC[C@@]34c5cc(-c6ccoc6)ccc5N(C)[C@]35OC[C@@]4(C(=O)OC)[C@H]1C[C@H]25 |
| InChI | InChI=1S/C26H28N2O4/c1-4-16-13-28-9-8-25-20-11-17(18-7-10-31-14-18)5-6-21(20)27(2)26(25)22(28)12-19(16)24(25,15-32-26)23(29)30-3/h4-7,10-11,14,19,22H,8-9,12-13,15H2,1-3H3/b16-4-/t19-,22-,24-,25-,26+/m0/s1 |
| InChIKey | HHFZBMASBYXCSQ-VXLBDLNNSA-N |
| XLogP | 3.57 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|