About 2-[[2-(4-ethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide
2-[[2-(4-ethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide (PubChem CID 171344507) has the molecular formula C22H24N2O2S
and a molecular weight of 380.51 g/mol. Its IUPAC name is 2-[[2-(4-ethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide.
Molecular Properties
| Compound Name | 2-[[2-(4-ethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide |
| PubChem CID | 171344507 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-[[2-(4-ethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide |
| SMILES | CCc1ccc(-c2nc(CSCC(=O)NCCc3ccccc3)co2)cc1 |
| InChI | InChI=1S/C22H24N2O2S/c1-2-17-8-10-19(11-9-17)22-24-20(14-26-22)15-27-16-21(25)23-13-12-18-6-4-3-5-7-18/h3-11,14H,2,12-13,15-16H2,1H3,(H,23,25) |
| InChIKey | YAMYZDXOSOYBAF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[2-(4-ethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(4-ethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide?
The IUPAC name of 2-[[2-(4-ethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide (CID 171344507) is 2-[[2-(4-ethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide.
What is the SMILES notation for 2-[[2-(4-ethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide?
The canonical SMILES for 2-[[2-(4-ethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide is CCc1ccc(-c2nc(CSCC(=O)NCCc3ccccc3)co2)cc1.
What is the InChIKey of 2-[[2-(4-ethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide?
The InChIKey is YAMYZDXOSOYBAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O2S/c1-2-17-8-10-19(11-9-17)22-24-20(14-26-22)15-27-16-21(25)23-13-12-18-6-4-3-5-7-18/h3-11,14H,2,12-13,15-16H2,1H3,(H,23,25).
What are the key properties of 2-[[2-(4-ethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide?
2-[[2-(4-ethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide has a molecular weight of 380.51 g/mol, XLogP of 4.50, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(4-ethylphenyl)-1,3-oxazol-4-yl]methylsulfanyl]-N-(2-phenylethyl)acetamide is sourced from PubChem (CID 171344507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).