About 3-[5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-(4-fluorophenyl)-2-methylpyridine
3-[5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-(4-fluorophenyl)-2-methylpyridine (PubChem CID 171344577) has the molecular formula C21H16F3N3
and a molecular weight of 367.37 g/mol. Its IUPAC name is 3-[5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-(4-fluorophenyl)-2-methylpyridine.
Molecular Properties
| Compound Name | 3-[5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-(4-fluorophenyl)-2-methylpyridine |
| PubChem CID | 171344577 |
| Molecular Formula | C21H16F3N3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 3-[5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-(4-fluorophenyl)-2-methylpyridine |
| SMILES | Cc1nc(-c2ccc(F)cc2)ccc1C1=NNC(c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C21H16F3N3/c1-12-18(6-7-19(25-12)13-2-4-15(22)5-3-13)21-11-20(26-27-21)14-8-16(23)10-17(24)9-14/h2-10,20,26H,11H2,1H3 |
| InChIKey | RSTLHNWVRBALFU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-(4-fluorophenyl)-2-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-(4-fluorophenyl)-2-methylpyridine?
The IUPAC name of 3-[5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-(4-fluorophenyl)-2-methylpyridine (CID 171344577) is 3-[5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-(4-fluorophenyl)-2-methylpyridine.
What is the SMILES notation for 3-[5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-(4-fluorophenyl)-2-methylpyridine?
The canonical SMILES for 3-[5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-(4-fluorophenyl)-2-methylpyridine is Cc1nc(-c2ccc(F)cc2)ccc1C1=NNC(c2cc(F)cc(F)c2)C1.
What is the InChIKey of 3-[5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-(4-fluorophenyl)-2-methylpyridine?
The InChIKey is RSTLHNWVRBALFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16F3N3/c1-12-18(6-7-19(25-12)13-2-4-15(22)5-3-13)21-11-20(26-27-21)14-8-16(23)10-17(24)9-14/h2-10,20,26H,11H2,1H3.
What are the key properties of 3-[5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-(4-fluorophenyl)-2-methylpyridine?
3-[5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-(4-fluorophenyl)-2-methylpyridine has a molecular weight of 367.37 g/mol, XLogP of 4.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(3,5-difluorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]-6-(4-fluorophenyl)-2-methylpyridine is sourced from PubChem (CID 171344577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).