C40H30N4O2 — CID 171344617
4-[5,15-bis(4-methylphenyl)-22,24-dihydro-21H-corrin-10-yl]benzoic acid (PubChem CID 171344617) has the molecular formula C40H30N4O2 and a molecular weight of 598.71 g/mol. Its IUPAC name is 4-[5,15-bis(4-methylphenyl)-22,24-dihydro-21H-corrin-10-yl]benzoic acid.
| Compound Name | 4-[5,15-bis(4-methylphenyl)-22,24-dihydro-21H-corrin-10-yl]benzoic acid |
|---|---|
| PubChem CID | 171344617 |
| Molecular Formula | C40H30N4O2 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | 4-[5,15-bis(4-methylphenyl)-22,24-dihydro-21H-corrin-10-yl]benzoic acid |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C(=O)O)cc4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4ccc([nH]4)c4ccc2[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C40H30N4O2/c1-23-3-7-25(8-4-23)37-31-17-15-29(41-31)30-16-18-32(42-30)38(26-9-5-24(2)6-10-26)34-20-22-36(44-34)39(35-21-19-33(37)43-35)27-11-13-28(14-12-27)40(45)46/h3-22,41-43H,1-2H3,(H,45,46)/b30-29-,37-31-,37-33-,38-32-,38-34-,39-35-,39-36- |
| InChIKey | DQGVXMJIMBKMGU-PPJLITIUSA-N |
| XLogP | 10.01 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |