C18H17N5O2S — CID 171345001
N-[[4-[(E)-(4-methoxyphenyl)methylideneamino]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]benzamide (PubChem CID 171345001) has the molecular formula C18H17N5O2S and a molecular weight of 367.43 g/mol. Its IUPAC name is N-[[4-[(E)-(4-methoxyphenyl)methylideneamino]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]benzamide.
| Compound Name | N-[[4-[(E)-(4-methoxyphenyl)methylideneamino]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 171345001 |
| Molecular Formula | C18H17N5O2S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[[4-[(E)-(4-methoxyphenyl)methylideneamino]-5-sulfanylidene-1H-1,2,4-triazol-3-yl]methyl]benzamide |
| SMILES | COc1ccc(/C=N/n2c(CNC(=O)c3ccccc3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C18H17N5O2S/c1-25-15-9-7-13(8-10-15)11-20-23-16(21-22-18(23)26)12-19-17(24)14-5-3-2-4-6-14/h2-11H,12H2,1H3,(H,19,24)(H,22,26)/b20-11+ |
| InChIKey | UXBRLWYRMJRULL-RGVLZGJSSA-N |
| XLogP | 2.76 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|