C28H36O5 — CID 171345079
(8aS)-2-[(3aR,4R,6aS)-4-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3a-methyl-2-oxo-3,4,5,6-tetrahydrocyclopenta[b]furan-6a-yl]-8a-methyl-7,8-dihydronaphthalene-1,4,6-trione (PubChem CID 171345079) has the molecular formula C28H36O5 and a molecular weight of 452.59 g/mol. Its IUPAC name is (8aS)-2-[(3aR,4R,6aS)-4-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3a-methyl-2-oxo-3,4,5,6-tetrahydrocyclopenta[b]furan-6a-yl]-8a-methyl-7,8-dihydronaphthalene-1,4,6-trione.
| Compound Name | (8aS)-2-[(3aR,4R,6aS)-4-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3a-methyl-2-oxo-3,4,5,6-tetrahydrocyclopenta[b]furan-6a-yl]-8a-methyl-7,8-dihydronaphthalene-1,4,6-trione |
|---|---|
| PubChem CID | 171345079 |
| Molecular Formula | C28H36O5 |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | (8aS)-2-[(3aR,4R,6aS)-4-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-3a-methyl-2-oxo-3,4,5,6-tetrahydrocyclopenta[b]furan-6a-yl]-8a-methyl-7,8-dihydronaphthalene-1,4,6-trione |
| SMILES | CC(C)[C@@H](C)/C=C/[C@@H](C)[C@H]1CC[C@]2(C3=CC(=O)C4=CC(=O)CC[C@]4(C)C3=O)OC(=O)C[C@]12C |
| InChI | InChI=1S/C28H36O5/c1-16(2)17(3)7-8-18(4)20-10-12-28(27(20,6)15-24(31)33-28)22-14-23(30)21-13-19(29)9-11-26(21,5)25(22)32/h7-8,13-14,16-18,20H,9-12,15H2,1-6H3/b8-7+/t17-,18+,20+,26-,27+,28+/m0/s1 |
| InChIKey | QMQPZDHECOIYHN-QUKUBZPXSA-N |
| XLogP | 4.95 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|