C36H42N8O8 — CID 171345201
bis[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenyl] bicyclo[2.2.2]octane-1,4-dicarboxylate (PubChem CID 171345201) has the molecular formula C36H42N8O8 and a molecular weight of 714.78 g/mol. Its IUPAC name is bis[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenyl] bicyclo[2.2.2]octane-1,4-dicarboxylate.
| Compound Name | bis[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenyl] bicyclo[2.2.2]octane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 171345201 |
| Molecular Formula | C36H42N8O8 |
| Molecular Weight | 714.78 g/mol |
| Exact Mass | 714.31 |
| IUPAC Name | bis[4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-dimethoxyphenyl] bicyclo[2.2.2]octane-1,4-dicarboxylate |
| SMILES | COc1cc(Cc2cnc(N)nc2N)cc(OC)c1OC(=O)C12CCC(C(=O)Oc3c(OC)cc(Cc4cnc(N)nc4N)cc3OC)(CC1)CC2 |
| InChI | InChI=1S/C36H42N8O8/c1-47-23-13-19(11-21-17-41-33(39)43-29(21)37)14-24(48-2)27(23)51-31(45)35-5-8-36(9-6-35,10-7-35)32(46)52-28-25(49-3)15-20(16-26(28)50-4)12-22-18-42-34(40)44-30(22)38/h13-18H,5-12H2,1-4H3,(H4,37,39,41,43)(H4,38,40,42,44) |
| InChIKey | ZVPGCHZEEQIYKO-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 245.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|