C21H39BClN3O4 — CID 171345217
2-amino-4-methyl-N-[2-oxo-2-[[(2S)-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]ethyl]pentanamide;hydrochloride (PubChem CID 171345217) has the molecular formula C21H39BClN3O4 and a molecular weight of 443.83 g/mol. Its IUPAC name is 2-amino-4-methyl-N-[2-oxo-2-[[(2S)-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]ethyl]pentanamide;hydrochloride.
| Compound Name | 2-amino-4-methyl-N-[2-oxo-2-[[(2S)-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]ethyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 171345217 |
| Molecular Formula | C21H39BClN3O4 |
| Molecular Weight | 443.83 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 2-amino-4-methyl-N-[2-oxo-2-[[(2S)-2-[(2R)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]propyl]amino]ethyl]pentanamide;hydrochloride |
| SMILES | CC(C)CC(N)C(=O)NCC(=O)NC[C@H](C)B1OC2CC3CC(C3(C)C)[C@@]2(C)O1.Cl |
| InChI | InChI=1S/C21H38BN3O4.ClH/c1-12(2)7-15(23)19(27)25-11-18(26)24-10-13(3)22-28-17-9-14-8-16(20(14,4)5)21(17,6)29-22;/h12-17H,7-11,23H2,1-6H3,(H,24,26)(H,25,27);1H/t13-,14?,15?,16?,17?,21+;/m0./s1 |
| InChIKey | FPLLAMYMXRJDQH-BSHULBQOSA-N |
| XLogP | 2.13 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.83 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|