About 1-(3-methoxyphenyl)sulfonyl-N-(4-morpholin-4-ylphenyl)pyrrolo[3,2-c]pyridin-6-amine
1-(3-methoxyphenyl)sulfonyl-N-(4-morpholin-4-ylphenyl)pyrrolo[3,2-c]pyridin-6-amine (PubChem CID 171345238) has the molecular formula C24H24N4O4S
and a molecular weight of 464.55 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)sulfonyl-N-(4-morpholin-4-ylphenyl)pyrrolo[3,2-c]pyridin-6-amine.
Molecular Properties
| Compound Name | 1-(3-methoxyphenyl)sulfonyl-N-(4-morpholin-4-ylphenyl)pyrrolo[3,2-c]pyridin-6-amine |
| PubChem CID | 171345238 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 1-(3-methoxyphenyl)sulfonyl-N-(4-morpholin-4-ylphenyl)pyrrolo[3,2-c]pyridin-6-amine |
| SMILES | COc1cccc(S(=O)(=O)n2ccc3cnc(Nc4ccc(N5CCOCC5)cc4)cc32)c1 |
| InChI | InChI=1S/C24H24N4O4S/c1-31-21-3-2-4-22(15-21)33(29,30)28-10-9-18-17-25-24(16-23(18)28)26-19-5-7-20(8-6-19)27-11-13-32-14-12-27/h2-10,15-17H,11-14H2,1H3,(H,25,26) |
| InChIKey | CRHSUNCSARELMU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methoxyphenyl)sulfonyl-N-(4-morpholin-4-ylphenyl)pyrrolo[3,2-c]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methoxyphenyl)sulfonyl-N-(4-morpholin-4-ylphenyl)pyrrolo[3,2-c]pyridin-6-amine?
The IUPAC name of 1-(3-methoxyphenyl)sulfonyl-N-(4-morpholin-4-ylphenyl)pyrrolo[3,2-c]pyridin-6-amine (CID 171345238) is 1-(3-methoxyphenyl)sulfonyl-N-(4-morpholin-4-ylphenyl)pyrrolo[3,2-c]pyridin-6-amine.
What is the SMILES notation for 1-(3-methoxyphenyl)sulfonyl-N-(4-morpholin-4-ylphenyl)pyrrolo[3,2-c]pyridin-6-amine?
The canonical SMILES for 1-(3-methoxyphenyl)sulfonyl-N-(4-morpholin-4-ylphenyl)pyrrolo[3,2-c]pyridin-6-amine is COc1cccc(S(=O)(=O)n2ccc3cnc(Nc4ccc(N5CCOCC5)cc4)cc32)c1.
What is the InChIKey of 1-(3-methoxyphenyl)sulfonyl-N-(4-morpholin-4-ylphenyl)pyrrolo[3,2-c]pyridin-6-amine?
The InChIKey is CRHSUNCSARELMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4O4S/c1-31-21-3-2-4-22(15-21)33(29,30)28-10-9-18-17-25-24(16-23(18)28)26-19-5-7-20(8-6-19)27-11-13-32-14-12-27/h2-10,15-17H,11-14H2,1H3,(H,25,26).
What are the key properties of 1-(3-methoxyphenyl)sulfonyl-N-(4-morpholin-4-ylphenyl)pyrrolo[3,2-c]pyridin-6-amine?
1-(3-methoxyphenyl)sulfonyl-N-(4-morpholin-4-ylphenyl)pyrrolo[3,2-c]pyridin-6-amine has a molecular weight of 464.55 g/mol, XLogP of 3.86, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methoxyphenyl)sulfonyl-N-(4-morpholin-4-ylphenyl)pyrrolo[3,2-c]pyridin-6-amine is sourced from PubChem (CID 171345238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).