C17H16N8O4S — CID 171345420
5-[[[5-[[(2-methyl-4-oxoquinazolin-3-yl)amino]methyl]-1,3,4-thiadiazol-2-yl]amino]methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 171345420) has the molecular formula C17H16N8O4S and a molecular weight of 428.43 g/mol. Its IUPAC name is 5-[[[5-[[(2-methyl-4-oxoquinazolin-3-yl)amino]methyl]-1,3,4-thiadiazol-2-yl]amino]methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[[5-[[(2-methyl-4-oxoquinazolin-3-yl)amino]methyl]-1,3,4-thiadiazol-2-yl]amino]methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 171345420 |
| Molecular Formula | C17H16N8O4S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | 5-[[[5-[[(2-methyl-4-oxoquinazolin-3-yl)amino]methyl]-1,3,4-thiadiazol-2-yl]amino]methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1nc2ccccc2c(=O)n1NCc1nnc(NCC2C(=O)NC(=O)NC2=O)s1 |
| InChI | InChI=1S/C17H16N8O4S/c1-8-20-11-5-3-2-4-9(11)15(28)25(8)19-7-12-23-24-17(30-12)18-6-10-13(26)21-16(29)22-14(10)27/h2-5,10,19H,6-7H2,1H3,(H,18,24)(H2,21,22,26,27,29) |
| InChIKey | UNSIGHLCEQWCNN-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 160.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|