About N-(4-imidazo[1,2-a]pyridin-3-yl-2-methylphenyl)-5-nitrofuran-2-carboxamide
N-(4-imidazo[1,2-a]pyridin-3-yl-2-methylphenyl)-5-nitrofuran-2-carboxamide (PubChem CID 171345511) has the molecular formula C19H14N4O4
and a molecular weight of 362.35 g/mol. Its IUPAC name is N-(4-imidazo[1,2-a]pyridin-3-yl-2-methylphenyl)-5-nitrofuran-2-carboxamide.
Molecular Properties
| Compound Name | N-(4-imidazo[1,2-a]pyridin-3-yl-2-methylphenyl)-5-nitrofuran-2-carboxamide |
| PubChem CID | 171345511 |
| Molecular Formula | C19H14N4O4 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-(4-imidazo[1,2-a]pyridin-3-yl-2-methylphenyl)-5-nitrofuran-2-carboxamide |
| SMILES | Cc1cc(-c2cnc3ccccn23)ccc1NC(=O)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C19H14N4O4/c1-12-10-13(15-11-20-17-4-2-3-9-22(15)17)5-6-14(12)21-19(24)16-7-8-18(27-16)23(25)26/h2-11H,1H3,(H,21,24) |
| InChIKey | QRJACQZHOBVARS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-imidazo[1,2-a]pyridin-3-yl-2-methylphenyl)-5-nitrofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-imidazo[1,2-a]pyridin-3-yl-2-methylphenyl)-5-nitrofuran-2-carboxamide?
The IUPAC name of N-(4-imidazo[1,2-a]pyridin-3-yl-2-methylphenyl)-5-nitrofuran-2-carboxamide (CID 171345511) is N-(4-imidazo[1,2-a]pyridin-3-yl-2-methylphenyl)-5-nitrofuran-2-carboxamide.
What is the SMILES notation for N-(4-imidazo[1,2-a]pyridin-3-yl-2-methylphenyl)-5-nitrofuran-2-carboxamide?
The canonical SMILES for N-(4-imidazo[1,2-a]pyridin-3-yl-2-methylphenyl)-5-nitrofuran-2-carboxamide is Cc1cc(-c2cnc3ccccn23)ccc1NC(=O)c1ccc([N+](=O)[O-])o1.
What is the InChIKey of N-(4-imidazo[1,2-a]pyridin-3-yl-2-methylphenyl)-5-nitrofuran-2-carboxamide?
The InChIKey is QRJACQZHOBVARS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N4O4/c1-12-10-13(15-11-20-17-4-2-3-9-22(15)17)5-6-14(12)21-19(24)16-7-8-18(27-16)23(25)26/h2-11H,1H3,(H,21,24).
What are the key properties of N-(4-imidazo[1,2-a]pyridin-3-yl-2-methylphenyl)-5-nitrofuran-2-carboxamide?
N-(4-imidazo[1,2-a]pyridin-3-yl-2-methylphenyl)-5-nitrofuran-2-carboxamide has a molecular weight of 362.35 g/mol, XLogP of 4.06, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-imidazo[1,2-a]pyridin-3-yl-2-methylphenyl)-5-nitrofuran-2-carboxamide is sourced from PubChem (CID 171345511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).