About 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]ethoxy]ethanol
2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]ethoxy]ethanol (PubChem CID 171345512) has the molecular formula C14H16N4O3S
and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]ethoxy]ethanol |
| PubChem CID | 171345512 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]ethoxy]ethanol |
| SMILES | COc1ccc2nc(-c3cn(CCOCCO)nn3)sc2c1 |
| InChI | InChI=1S/C14H16N4O3S/c1-20-10-2-3-11-13(8-10)22-14(15-11)12-9-18(17-16-12)4-6-21-7-5-19/h2-3,8-9,19H,4-7H2,1H3 |
| InChIKey | BKWYEWKCRPQQLO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]ethoxy]ethanol?
The IUPAC name of 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]ethoxy]ethanol (CID 171345512) is 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]ethoxy]ethanol.
What is the SMILES notation for 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]ethoxy]ethanol?
The canonical SMILES for 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]ethoxy]ethanol is COc1ccc2nc(-c3cn(CCOCCO)nn3)sc2c1.
What is the InChIKey of 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]ethoxy]ethanol?
The InChIKey is BKWYEWKCRPQQLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O3S/c1-20-10-2-3-11-13(8-10)22-14(15-11)12-9-18(17-16-12)4-6-21-7-5-19/h2-3,8-9,19H,4-7H2,1H3.
What are the key properties of 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]ethoxy]ethanol?
2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]ethoxy]ethanol has a molecular weight of 320.37 g/mol, XLogP of 1.57, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(6-methoxy-1,3-benzothiazol-2-yl)triazol-1-yl]ethoxy]ethanol is sourced from PubChem (CID 171345512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).