About (7-amino-2,8-dimethylphenothiazin-3-ylidene)-dimethylazanium
(7-amino-2,8-dimethylphenothiazin-3-ylidene)-dimethylazanium (PubChem CID 171345548) has the molecular formula C16H18N3S+
and a molecular weight of 284.41 g/mol. Its IUPAC name is (7-amino-2,8-dimethylphenothiazin-3-ylidene)-dimethylazanium.
Molecular Properties
| Compound Name | (7-amino-2,8-dimethylphenothiazin-3-ylidene)-dimethylazanium |
| PubChem CID | 171345548 |
| Molecular Formula | C16H18N3S+ |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | (7-amino-2,8-dimethylphenothiazin-3-ylidene)-dimethylazanium |
| SMILES | Cc1cc2nc3cc(C)c(=[N+](C)C)cc-3sc2cc1N |
| InChI | InChI=1S/C16H17N3S/c1-9-5-12-15(7-11(9)17)20-16-8-14(19(3)4)10(2)6-13(16)18-12/h5-8,17H,1-4H3/p+1 |
| InChIKey | AEEPSDQYOANWFD-UHFFFAOYSA-O |
| XLogP | 2.63 |
| TPSA | 41.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (7-amino-2,8-dimethylphenothiazin-3-ylidene)-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-amino-2,8-dimethylphenothiazin-3-ylidene)-dimethylazanium?
The IUPAC name of (7-amino-2,8-dimethylphenothiazin-3-ylidene)-dimethylazanium (CID 171345548) is (7-amino-2,8-dimethylphenothiazin-3-ylidene)-dimethylazanium.
What is the SMILES notation for (7-amino-2,8-dimethylphenothiazin-3-ylidene)-dimethylazanium?
The canonical SMILES for (7-amino-2,8-dimethylphenothiazin-3-ylidene)-dimethylazanium is Cc1cc2nc3cc(C)c(=[N+](C)C)cc-3sc2cc1N.
What is the InChIKey of (7-amino-2,8-dimethylphenothiazin-3-ylidene)-dimethylazanium?
The InChIKey is AEEPSDQYOANWFD-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H17N3S/c1-9-5-12-15(7-11(9)17)20-16-8-14(19(3)4)10(2)6-13(16)18-12/h5-8,17H,1-4H3/p+1.
What are the key properties of (7-amino-2,8-dimethylphenothiazin-3-ylidene)-dimethylazanium?
(7-amino-2,8-dimethylphenothiazin-3-ylidene)-dimethylazanium has a molecular weight of 284.41 g/mol, XLogP of 2.63, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-amino-2,8-dimethylphenothiazin-3-ylidene)-dimethylazanium is sourced from PubChem (CID 171345548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).