C19H16F5N3OSe — CID 171345582
2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[4-(trifluoromethyl)phenyl]methylselanyl]propan-2-ol (PubChem CID 171345582) has the molecular formula C19H16F5N3OSe and a molecular weight of 476.31 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[4-(trifluoromethyl)phenyl]methylselanyl]propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[4-(trifluoromethyl)phenyl]methylselanyl]propan-2-ol |
|---|---|
| PubChem CID | 171345582 |
| Molecular Formula | C19H16F5N3OSe |
| Molecular Weight | 476.31 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)-3-[[4-(trifluoromethyl)phenyl]methylselanyl]propan-2-ol |
| SMILES | OC(C[Se]Cc1ccc(C(F)(F)F)cc1)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H16F5N3OSe/c20-15-5-6-16(17(21)7-15)18(28,9-27-12-25-11-26-27)10-29-8-13-1-3-14(4-2-13)19(22,23)24/h1-7,11-12,28H,8-10H2 |
| InChIKey | DFNFMXQIRVYTQM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|