C27H23FN6S — CID 171345586
N-[(E)-[4-[(3-fluorophenyl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 171345586) has the molecular formula C27H23FN6S and a molecular weight of 482.59 g/mol. Its IUPAC name is N-[(E)-[4-[(3-fluorophenyl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[(E)-[4-[(3-fluorophenyl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 171345586 |
| Molecular Formula | C27H23FN6S |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | N-[(E)-[4-[(3-fluorophenyl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-ylidene]amino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | Cc1c(/N=C/c2cccc(F)c2)/c(=N\Nc2nc(-c3ccccc3)cs2)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C27H23FN6S/c1-19-25(29-17-20-10-9-13-22(28)16-20)26(34(33(19)2)23-14-7-4-8-15-23)31-32-27-30-24(18-35-27)21-11-5-3-6-12-21/h3-18H,1-2H3,(H,30,32)/b29-17+,31-26+ |
| InChIKey | WNAOUCKKORJFCC-CVRAUOMMSA-N |
| XLogP | 6.07 |
| TPSA | 59.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|