C8H4N4O5S — CID 171345592
5-(2,5-dinitrophenyl)-3H-1,3,4-oxadiazole-2-thione (PubChem CID 171345592) has the molecular formula C8H4N4O5S and a molecular weight of 268.21 g/mol. Its IUPAC name is 5-(2,5-dinitrophenyl)-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(2,5-dinitrophenyl)-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 171345592 |
| Molecular Formula | C8H4N4O5S |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | 5-(2,5-dinitrophenyl)-3H-1,3,4-oxadiazole-2-thione |
| SMILES | O=[N+]([O-])c1ccc([N+](=O)[O-])c(-c2n[nH]c(=S)o2)c1 |
| InChI | InChI=1S/C8H4N4O5S/c13-11(14)4-1-2-6(12(15)16)5(3-4)7-9-10-8(18)17-7/h1-3H,(H,10,18) |
| InChIKey | MRTHYEKVYHVKHR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|