C19H24FN3O3 — CID 171345622
(2R,3R,4R,5R)-5-[5-(3,3-dimethylbut-1-ynyl)-4-methylpyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 171345622) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-[5-(3,3-dimethylbut-1-ynyl)-4-methylpyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-[5-(3,3-dimethylbut-1-ynyl)-4-methylpyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 171345622 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | (2R,3R,4R,5R)-5-[5-(3,3-dimethylbut-1-ynyl)-4-methylpyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | Cc1ncnc2c1c(C#CC(C)(C)C)cn2[C@@H]1O[C@H](CO)[C@@H](O)[C@@]1(C)F |
| InChI | InChI=1S/C19H24FN3O3/c1-11-14-12(6-7-18(2,3)4)8-23(16(14)22-10-21-11)17-19(5,20)15(25)13(9-24)26-17/h8,10,13,15,17,24-25H,9H2,1-5H3/t13-,15-,17-,19-/m1/s1 |
| InChIKey | LJYOMDSZXYPQPV-LRCYWBKYSA-N |
| XLogP | 2.12 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|