C20H30O2 — CID 171345982
3-[(E)-4-methyl-6-[(1R,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]hex-3-enyl]-2H-furan-5-one (PubChem CID 171345982) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is 3-[(E)-4-methyl-6-[(1R,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]hex-3-enyl]-2H-furan-5-one.
| Compound Name | 3-[(E)-4-methyl-6-[(1R,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]hex-3-enyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 171345982 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 3-[(E)-4-methyl-6-[(1R,6R)-1,2,6-trimethylcyclohex-2-en-1-yl]hex-3-enyl]-2H-furan-5-one |
| SMILES | CC1=CCC[C@@H](C)[C@@]1(C)CC/C(C)=C/CCC1=CC(=O)OC1 |
| InChI | InChI=1S/C20H30O2/c1-15(7-5-10-18-13-19(21)22-14-18)11-12-20(4)16(2)8-6-9-17(20)3/h7-8,13,17H,5-6,9-12,14H2,1-4H3/b15-7+/t17-,20+/m1/s1 |
| InChIKey | MZXRVPMOCALWEL-AIAYJJJXSA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|