C14H18O3 — CID 171346030
(1R,2R,6S)-1-[(1E,5E)-hepta-1,5-dien-3-ynyl]-6-(hydroxymethyl)cyclohex-3-ene-1,2-diol (PubChem CID 171346030) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is (1R,2R,6S)-1-[(1E,5E)-hepta-1,5-dien-3-ynyl]-6-(hydroxymethyl)cyclohex-3-ene-1,2-diol.
| Compound Name | (1R,2R,6S)-1-[(1E,5E)-hepta-1,5-dien-3-ynyl]-6-(hydroxymethyl)cyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 171346030 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (1R,2R,6S)-1-[(1E,5E)-hepta-1,5-dien-3-ynyl]-6-(hydroxymethyl)cyclohex-3-ene-1,2-diol |
| SMILES | C/C=C/C#C/C=C/[C@@]1(O)[C@H](CO)CC=C[C@H]1O |
| InChI | InChI=1S/C14H18O3/c1-2-3-4-5-6-10-14(17)12(11-15)8-7-9-13(14)16/h2-3,6-7,9-10,12-13,15-17H,8,11H2,1H3/b3-2+,10-6+/t12-,13+,14+/m0/s1 |
| InChIKey | JTPMXDWLQMHSLX-VAFRZQRYSA-N |
| XLogP | 0.78 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|